LY88074 Trimethyl ether structure
|
Common Name | LY88074 Trimethyl ether | ||
|---|---|---|---|---|
| CAS Number | 63675-87-6 | Molecular Weight | 404.47800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H20O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LY88074 Trimethyl etherLY88074 Trimethyl ether (Example 1) is useful for the inhibition of the various estrogen deficient conditions, which are associated with estrogen deprivation syndrome including osteoporosis and hyperlipidemia[1]. |
| Name | [6-methoxy-2-(4-methoxyphenyl)benzo[b]thiophen-3-yl](4-methoxy-phenyl)-methanone |
|---|---|
| Synonym | More Synonyms |
| Description | LY88074 Trimethyl ether (Example 1) is useful for the inhibition of the various estrogen deficient conditions, which are associated with estrogen deprivation syndrome including osteoporosis and hyperlipidemia[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H20O4S |
|---|---|
| Molecular Weight | 404.47800 |
| Exact Mass | 404.10800 |
| PSA | 73.00000 |
| LogP | 5.82510 |
| InChIKey | RFSCQXPHEFFAAZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2c(-c3ccc(OC)cc3)sc3cc(OC)ccc23)cc1 |
| [6-Methoxy-2-(4-methoxy-phenyl)-benzo[b]thiophen-3-yl]-(4-methoxy -phenyl)-methanone |
| 6-methoxy-2-(p-methoxyphenyl)benzo[b]thien-3-yl p-methoxyphenyl ketone |
| 3-(4'-methoxybenzoyl)-2-(4'-methoxyphenyl)-6-methoxybenzo[b]thiophene |
| [6-Methoxy-2-(4-methoxyphenyl)benzo[b]thien-3-yl] (4-methoxyphenyl)methanone |
| 2-(4-methoxyphenyl)-3-(4-methoxybenzoyl)-6-methoxybenzothiophene |
| (6-methoxy-2-(4-methoxyphenyl)benzo[b]thiophen-3-yl)(4-methoxyphenyl)methanone |