6-methyl-5-methylsulfanyl-1-benzothiophene-4,7-dione structure
|
Common Name | 6-methyl-5-methylsulfanyl-1-benzothiophene-4,7-dione | ||
|---|---|---|---|---|
| CAS Number | 63693-30-1 | Molecular Weight | 224.29900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methyl-5-methylsulfanyl-1-benzothiophene-4,7-dione |
|---|
| Molecular Formula | C10H8O2S2 |
|---|---|
| Molecular Weight | 224.29900 |
| Exact Mass | 223.99700 |
| PSA | 87.68000 |
| LogP | 2.76410 |
| InChIKey | UWEBTCRGIKDBHO-UHFFFAOYSA-N |
| SMILES | CSC1=C(C)C(=O)c2sccc2C1=O |
|
~0%
6-methyl-5-meth... CAS#:63693-30-1 |
| Literature: Thomson, Ronald H.; Worthington, Roger D. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 282 - 288 |