Benzamide,N-[5-[(9,10-dihydro-9,10-dioxo-1-anthracenyl)amino]-9,10-dihydro-9,10-dioxo-1-anthracenyl] structure
|
Common Name | Benzamide,N-[5-[(9,10-dihydro-9,10-dioxo-1-anthracenyl)amino]-9,10-dihydro-9,10-dioxo-1-anthracenyl] | ||
|---|---|---|---|---|
| CAS Number | 6370-69-0 | Molecular Weight | 548.54400 | |
| Density | 1.468g/cm3 | Boiling Point | 726.1ºC at 760 mmHg | |
| Molecular Formula | C35H20N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.3ºC | |
| Name | N-[5-[(9,10-dioxoanthracen-1-yl)amino]-9,10-dioxoanthracen-1-yl]benzamide |
|---|
| Density | 1.468g/cm3 |
|---|---|
| Boiling Point | 726.1ºC at 760 mmHg |
| Molecular Formula | C35H20N2O5 |
| Molecular Weight | 548.54400 |
| Flash Point | 200.3ºC |
| Exact Mass | 548.13700 |
| PSA | 109.41000 |
| LogP | 6.37930 |
| Index of Refraction | 1.768 |
| InChIKey | HYGDUEQJCUPFFW-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc2c1C(=O)c1cccc(Nc3cccc4c3C(=O)c3ccccc3C4=O)c1C2=O)c1ccccc1 |
|
~%
Benzamide,N-[5-... CAS#:6370-69-0 |
| Literature: Bradley; Pandit Journal of the Chemical Society, 1955 , p. 3399,3404 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |