ethoxymethyl(triphenyl)phosphanium,chloride structure
|
Common Name | ethoxymethyl(triphenyl)phosphanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 63710-30-5 | Molecular Weight | 356.82600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22ClOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethoxymethyl(triphenyl)phosphanium,chloride |
|---|
| Molecular Formula | C21H22ClOP |
|---|---|
| Molecular Weight | 356.82600 |
| Exact Mass | 356.11000 |
| PSA | 22.82000 |
| LogP | 0.97850 |
| InChIKey | OSABVSQWANTQLX-UHFFFAOYSA-M |
| SMILES | CCOC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
|
~%
ethoxymethyl(tr... CAS#:63710-30-5 |
| Literature: Barrett; Barton; Russell; Widdowson Journal of the Chemical Society. Perkin transactions 1, 1977 , # 6 p. 631 - 643 |