4-bromobenzo[a]anthracene-7,12-dione structure
|
Common Name | 4-bromobenzo[a]anthracene-7,12-dione | ||
|---|---|---|---|---|
| CAS Number | 63715-52-6 | Molecular Weight | 337.16700 | |
| Density | 1.61g/cm3 | Boiling Point | 517.3ºC at 760 mmHg | |
| Molecular Formula | C18H9BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.3ºC | |
| Name | 4-bromobenzo[a]anthracene-7,12-dione |
|---|
| Density | 1.61g/cm3 |
|---|---|
| Boiling Point | 517.3ºC at 760 mmHg |
| Molecular Formula | C18H9BrO2 |
| Molecular Weight | 337.16700 |
| Flash Point | 169.3ºC |
| Exact Mass | 335.97900 |
| PSA | 34.14000 |
| LogP | 4.37770 |
| Index of Refraction | 1.737 |
| InChIKey | NXRTWAFFQRALPM-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc1c(Br)cccc21 |
|
~99%
4-bromobenzo[a]... CAS#:63715-52-6 |
| Literature: Cho, Bongsup P.; Harvey, Ronald G. Journal of Organic Chemistry, 1987 , vol. 52, # 26 p. 5668 - 5678 |
|
~%
4-bromobenzo[a]... CAS#:63715-52-6 |
| Literature: Johnson; Weinmayr; Adams Journal of the American Chemical Society, 1932 , vol. 54, p. 3289,3294 |