(S)-[(2R)-5-ethenyl-1-propyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol,bromide
Modify Date: 2025-11-18 20:40:51
![(S)-[(2R)-5-ethenyl-1-propyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol,bromide Structure](https://image.chemsrc.com/caspic/253/63717-12-4.png)
(S)-[(2R)-5-ethenyl-1-propyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol,bromide structure
|
Common Name | (S)-[(2R)-5-ethenyl-1-propyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol,bromide | ||
|---|---|---|---|---|
| CAS Number | 63717-12-4 | Molecular Weight | 447.40800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H31BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (S)-[(2R)-5-ethenyl-1-propyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H31BrN2O2 |
|---|---|
| Molecular Weight | 447.40800 |
| Exact Mass | 446.15700 |
| PSA | 42.35000 |
| LogP | 1.06080 |
| InChIKey | DSXBQRQLQMPKOA-XJXJHPFJSA-M |
| SMILES | C=CC1C[N+]2(CCC)CCC1CC2C(O)c1ccnc2ccc(OC)cc12.[Br-] |
| Cinchonan-9-ol,6'-methoxy-,(8alpha,9R)-,compd with 1-bromopropane (1:1) |
| (S)-[(2R)-5-ethenyl-1-propyl-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol bromide |
| Quinine,n-propyl bromide |
| Propane,1-bromo-,compd. with (8alpha,9R)-6'methoxycinchonan-9-ol (1:1) |