Dimethyl 4-aminoisophthalate structure
|
Common Name | Dimethyl 4-aminoisophthalate | ||
|---|---|---|---|---|
| CAS Number | 63746-12-3 | Molecular Weight | 209.199 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 351.9±22.0 °C at 760 mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.1±18.7 °C | |
| Name | dimethyl 4-aminobenzene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 351.9±22.0 °C at 760 mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.199 |
| Flash Point | 178.1±18.7 °C |
| Exact Mass | 209.068802 |
| PSA | 78.62000 |
| LogP | 2.79 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | QWENMFNFBJHLTE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(N)c(C(=O)OC)c1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| dimethyl 2-aminoisophthalate |
| 1,3-Benzenedicarboxylic acid, 4-amino-, dimethyl ester |
| dimethyl 4-aminoisophtalate |
| 4-Amino-isophthalsaeure-dimethylester |
| 4-amino-1,3-benzenedicarboxylic acid,dimethyl ester |
| Dimethyl 4-aminoisophthalate |
| 4-amino-isophthalic acid dimethyl ester |