Ethanol,2-[(diphenylmethyl)methylamino]-, hydrochloride (1:1) structure
|
Common Name | Ethanol,2-[(diphenylmethyl)methylamino]-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 63765-72-0 | Molecular Weight | 277.78900 | |
| Density | 1.078g/cm3 | Boiling Point | 350.2ºC at 760 mmHg | |
| Molecular Formula | C16H20ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.4ºC | |
| Name | 2-[benzhydryl(methyl)amino]ethanol,hydrochloride |
|---|
| Density | 1.078g/cm3 |
|---|---|
| Boiling Point | 350.2ºC at 760 mmHg |
| Molecular Formula | C16H20ClNO |
| Molecular Weight | 277.78900 |
| Flash Point | 129.4ºC |
| Exact Mass | 277.12300 |
| PSA | 23.47000 |
| LogP | 3.50210 |
| Index of Refraction | 1.582 |
| InChIKey | LPAKVWYPNNCYRA-UHFFFAOYSA-N |
| SMILES | CN(CCO)C(c1ccccc1)c1ccccc1.Cl |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |