7,8-dimethyl-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid structure
|
Common Name | 7,8-dimethyl-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 63768-47-8 | Molecular Weight | 285.25200 | |
| Density | 1.522 g/cm3 | Boiling Point | 606.751ºC at 760 mmHg | |
| Molecular Formula | C15H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.751ºC | |
| Name | 7,8-dimethyl-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.522 g/cm3 |
|---|---|
| Boiling Point | 606.751ºC at 760 mmHg |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.25200 |
| Flash Point | 320.751ºC |
| Exact Mass | 285.06400 |
| PSA | 100.63000 |
| LogP | 2.36180 |
| InChIKey | KKCFYNQIBLXNSC-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c([nH]c(=O)c3c(=O)cc(C(=O)O)oc32)c1C |
|
~%
7,8-dimethyl-4,... CAS#:63768-47-8 |
| Literature: Morinaka; Takahashi; Hata; Yomada European Journal of Medicinal Chemistry, 1981 , vol. 16, # 3 p. 251 - 256 |
|
~%
7,8-dimethyl-4,... CAS#:63768-47-8 |
| Literature: Morinaka; Takahashi; Hata; Yomada European Journal of Medicinal Chemistry, 1981 , vol. 16, # 3 p. 251 - 256 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| MY 1250 |
| Bay w 8199 |