6-Methoxy-N,2-dimethyl-1-benzofuran-3-carboxamide structure
|
Common Name | 6-Methoxy-N,2-dimethyl-1-benzofuran-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 638217-07-9 | Molecular Weight | 219.236 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 386.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.2±27.9 °C | |
| Name | 6-methoxy-N,2-dimethyl-1-benzofuran-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 386.0±42.0 °C at 760 mmHg |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.236 |
| Flash Point | 187.2±27.9 °C |
| Exact Mass | 219.089539 |
| PSA | 54.96000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | QLDCFCVMWPPGRX-UHFFFAOYSA-N |
| SMILES | CNC(=O)c1c(C)oc2cc(OC)ccc12 |
| HS Code | 2932999099 |
|---|
|
~55%
6-Methoxy-N,2-d... CAS#:638217-07-9 |
| Literature: PFIZER INC. Patent: WO2005/63739 A1, 2005 ; Location in patent: Page/Page column 51 ; WO 2005/063739 A1 |
|
~%
6-Methoxy-N,2-d... CAS#:638217-07-9 |
| Literature: PFIZER PRODUCTS INC. Patent: WO2007/66181 A2, 2007 ; Location in patent: Page/Page column 25-26 ; WO 2007/066181 A2 |
|
~78%
6-Methoxy-N,2-d... CAS#:638217-07-9 |
| Literature: Agouron Pharmaceuticals, Inc. Patent: US2004/9965 A1, 2004 ; |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Benzofurancarboxamide,6-methoxy-N,2-dimethyl |
| 6-Methoxy-N,2-dimethylbenzofuran-3-carboxamide |
| 3-Benzofurancarboxamide, 6-methoxy-N,2-dimethyl- |
| 6-Methoxy-N,2-dimethyl-1-benzofuran-3-carboxamide |