1-(10H-Phenothiazin-10-yl)-2-pyrrolizino-1-propanone structure
|
Common Name | 1-(10H-Phenothiazin-10-yl)-2-pyrrolizino-1-propanone | ||
|---|---|---|---|---|
| CAS Number | 63834-18-4 | Molecular Weight | 324.44000 | |
| Density | 1.256g/cm3 | Boiling Point | 528.8ºC at 760 mmHg | |
| Molecular Formula | C19H20N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.6ºC | |
| Name | 1-phenothiazin-10-yl-2-pyrrolidin-1-ylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.256g/cm3 |
|---|---|
| Boiling Point | 528.8ºC at 760 mmHg |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.44000 |
| Flash Point | 273.6ºC |
| Exact Mass | 324.13000 |
| PSA | 48.85000 |
| LogP | 4.30310 |
| Index of Refraction | 1.654 |
| InChIKey | AUXLHDRYVJNWFW-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N1c2ccccc2Sc2ccccc21)N1CCCC1 |
| HS Code | 2934300000 |
|---|
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| usaf xr-8 |