2,2-Diethyl-1,3-propanediol 1,3-bis(N,N-dimethylcarbamate) structure
|
Common Name | 2,2-Diethyl-1,3-propanediol 1,3-bis(N,N-dimethylcarbamate) | ||
|---|---|---|---|---|
| CAS Number | 63834-75-3 | Molecular Weight | 333.55400 | |
| Density | 1.036g/cm3 | Boiling Point | 353.2ºC at 760 mmHg | |
| Molecular Formula | C21H39N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.4ºC | |
| Name | 1,3,5-tricyclohexyl-1,3,5-triazinane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.036g/cm3 |
|---|---|
| Boiling Point | 353.2ºC at 760 mmHg |
| Molecular Formula | C21H39N3 |
| Molecular Weight | 333.55400 |
| Flash Point | 167.4ºC |
| Exact Mass | 333.31400 |
| PSA | 9.72000 |
| LogP | 4.59030 |
| Index of Refraction | 1.465 |
| InChIKey | SYJOHJHUOWQNTH-UHFFFAOYSA-N |
| SMILES | CCC(CC)(COC(=O)N(C)C)COC(=O)N(C)C |
| HS Code | 2924199090 |
|---|
|
~%
2,2-Diethyl-1,3... CAS#:63834-75-3 |
| Literature: Schneider,G. et al. Monatshefte fuer Chemie, 1963 , vol. 94, p. 426 - 433 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,3,5-Triazine,1,3,5-tricyclohexylhexahydro |