2-(4-chlorophenyl)-5-methylsulfonyl-1,3,4-thiadiazole structure
|
Common Name | 2-(4-chlorophenyl)-5-methylsulfonyl-1,3,4-thiadiazole | ||
|---|---|---|---|---|
| CAS Number | 63857-87-4 | Molecular Weight | 274.74700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7ClN2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-chlorophenyl)-5-methylsulfonyl-1,3,4-thiadiazole |
|---|
| Molecular Formula | C9H7ClN2O2S2 |
|---|---|
| Molecular Weight | 274.74700 |
| Exact Mass | 273.96400 |
| PSA | 96.54000 |
| LogP | 3.34280 |
| InChIKey | GYXLJGJBLUNOJG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1nnc(-c2ccc(Cl)cc2)s1 |
|
~29%
2-(4-chlorophen... CAS#:63857-87-4 |
| Literature: Kubota, Seiju; Toyooka, Kouhei; Ikeda, Junichi; Yamamoto, Naoya; Shibuya, Masayuki Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 5 p. 967 - 971 |
|
~%
2-(4-chlorophen... CAS#:63857-87-4 |
| Literature: Kubota, Seiju; Toyooka, Kouhei; Ikeda, Junichi; Yamamoto, Naoya; Shibuya, Masayuki Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 5 p. 967 - 971 |