butyl 2-(2-hydroxy-2-phenyl-acetyl)sulfanylacetate structure
|
Common Name | butyl 2-(2-hydroxy-2-phenyl-acetyl)sulfanylacetate | ||
|---|---|---|---|---|
| CAS Number | 63860-16-2 | Molecular Weight | 282.35500 | |
| Density | 1.206g/cm3 | Boiling Point | 403.7ºC at 760 mmHg | |
| Molecular Formula | C14H18O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.9ºC | |
| Name | butyl 2-(2-hydroxy-2-phenylacetyl)sulfanylacetate |
|---|
| Density | 1.206g/cm3 |
|---|---|
| Boiling Point | 403.7ºC at 760 mmHg |
| Molecular Formula | C14H18O4S |
| Molecular Weight | 282.35500 |
| Flash Point | 197.9ºC |
| Exact Mass | 282.09300 |
| PSA | 88.90000 |
| LogP | 2.32310 |
| Index of Refraction | 1.553 |
| InChIKey | CBKNHLGCYRZQQW-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)CSC(=O)C(O)c1ccccc1 |
|
~%
butyl 2-(2-hydr... CAS#:63860-16-2 |
| Literature: Hau,S.S. et al. Journal of Medicinal Chemistry, 1977 , vol. 20, p. 1239 - 1242 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |