methyl 3-(2-hydroxy-2-phenyl-acetyl)sulfanylpropanoate structure
|
Common Name | methyl 3-(2-hydroxy-2-phenyl-acetyl)sulfanylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 63860-18-4 | Molecular Weight | 254.30200 | |
| Density | 1.264g/cm3 | Boiling Point | 393ºC at 760 mmHg | |
| Molecular Formula | C12H14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.5ºC | |
| Name | methyl 3-(2-hydroxy-2-phenylacetyl)sulfanylpropanoate |
|---|
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 393ºC at 760 mmHg |
| Molecular Formula | C12H14O4S |
| Molecular Weight | 254.30200 |
| Flash Point | 191.5ºC |
| Exact Mass | 254.06100 |
| PSA | 88.90000 |
| LogP | 1.54290 |
| Index of Refraction | 1.566 |
| InChIKey | BYZKQZUJEKNDOE-UHFFFAOYSA-N |
| SMILES | COC(=O)CCSC(=O)C(O)c1ccccc1 |
|
~%
methyl 3-(2-hyd... CAS#:63860-18-4 |
| Literature: Hau,S.S. et al. Journal of Medicinal Chemistry, 1977 , vol. 20, p. 1239 - 1242 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |