Oxazolo[5,4-d]pyrimidine-5,7(4H,6H)-dione,2-(4-chlorophenyl)-4,6-dimethyl structure
|
Common Name | Oxazolo[5,4-d]pyrimidine-5,7(4H,6H)-dione,2-(4-chlorophenyl)-4,6-dimethyl | ||
|---|---|---|---|---|
| CAS Number | 63873-75-6 | Molecular Weight | 291.69000 | |
| Density | 1.425g/cm3 | Boiling Point | 462.6ºC at 760 mmHg | |
| Molecular Formula | C13H10ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.6ºC | |
| Name | 2-(4-chlorophenyl)-4,6-dimethyl-[1,3]oxazolo[5,4-d]pyrimidine-5,7-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.425g/cm3 |
|---|---|
| Boiling Point | 462.6ºC at 760 mmHg |
| Molecular Formula | C13H10ClN3O3 |
| Molecular Weight | 291.69000 |
| Flash Point | 233.6ºC |
| Exact Mass | 291.04100 |
| PSA | 70.03000 |
| LogP | 1.54560 |
| Index of Refraction | 1.605 |
| InChIKey | ZUAIZTFYBJEYHN-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2nc(-c3ccc(Cl)cc3)oc2n(C)c1=O |
|
~%
Oxazolo[5,4-d]p... CAS#:63873-75-6 |
| Literature: Senga; Sato; Nishigaki Chemical and Pharmaceutical Bulletin, 1978 , vol. 26, # 3 p. 765 - 769 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-(4-Chlorophenyl)-4,6-dimethyl(1,3)oxazolo(5,4-d)pyrimidine-5,7(4H,6H)-dione |