Benzoic acid,4-methyl-2-nitro-3-(phenylmethoxy)-, 2-(4-morpholinyl)ethyl ester structure
|
Common Name | Benzoic acid,4-methyl-2-nitro-3-(phenylmethoxy)-, 2-(4-morpholinyl)ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 63879-24-3 | Molecular Weight | 400.42500 | |
| Density | 1.246g/cm3 | Boiling Point | 570ºC at 760 mmHg | |
| Molecular Formula | C21H24N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.5ºC | |
| Name | 2-morpholin-4-ylethyl 4-methyl-2-nitro-3-phenylmethoxybenzoate |
|---|
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 570ºC at 760 mmHg |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.42500 |
| Flash Point | 298.5ºC |
| Exact Mass | 400.16300 |
| PSA | 93.82000 |
| LogP | 3.43230 |
| Index of Refraction | 1.579 |
| InChIKey | AZLWYSPSJKDOCJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)OCCN2CCOCC2)c([N+](=O)[O-])c1OCc1ccccc1 |
|
~%
Benzoic acid,4-... CAS#:63879-24-3 |
| Literature: Jain,P.C. et al. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1977 , vol. 15, p. 163 - 164 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |