3H-Phenoxazine-1,9-dicarboxamide,2-amino-4,6-dimethyl-N1,N9-bis[2-(4-methylphenyl)ethyl]-3-oxo- structure
|
Common Name | 3H-Phenoxazine-1,9-dicarboxamide,2-amino-4,6-dimethyl-N1,N9-bis[2-(4-methylphenyl)ethyl]-3-oxo- | ||
|---|---|---|---|---|
| CAS Number | 63879-45-8 | Molecular Weight | 562.65800 | |
| Density | 1.27g/cm3 | Boiling Point | 754.2ºC at 760mmHg | |
| Molecular Formula | C34H34N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 409.9ºC | |
| Name | 2-amino-4,6-dimethyl-1-N,9-N-bis[2-(4-methylphenyl)ethyl]-3-oxophenoxazine-1,9-dicarboxamide |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 754.2ºC at 760mmHg |
| Molecular Formula | C34H34N4O4 |
| Molecular Weight | 562.65800 |
| Flash Point | 409.9ºC |
| Exact Mass | 562.25800 |
| PSA | 127.32000 |
| LogP | 6.41660 |
| Index of Refraction | 1.647 |
| InChIKey | FEEUVCYPSREKNQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(CCNC(=O)c2c3nc4c(C(=O)NCCc5ccc(C)cc5)ccc(C)c4oc-3c(C)c(=O)c2N)cc1 |
|
~%
3H-Phenoxazine-... CAS#:63879-45-8 |
| Literature: Jain,P.C. et al. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1977 , vol. 15, p. 163 - 164 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |