2-amino-N,N-dibenzyl-4,6-dimethyl-3-oxo-phenoxazine-1,9-dicarboxamide structure
|
Common Name | 2-amino-N,N-dibenzyl-4,6-dimethyl-3-oxo-phenoxazine-1,9-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 63879-48-1 | Molecular Weight | 506.55200 | |
| Density | 1.33g/cm3 | Boiling Point | 721.6ºC at 760 mmHg | |
| Molecular Formula | C30H26N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 390.2ºC | |
| Name | 2-amino-1-N,9-N-dibenzyl-4,6-dimethyl-3-oxophenoxazine-1,9-dicarboxamide |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 721.6ºC at 760 mmHg |
| Molecular Formula | C30H26N4O4 |
| Molecular Weight | 506.55200 |
| Flash Point | 390.2ºC |
| Exact Mass | 506.19500 |
| PSA | 127.32000 |
| LogP | 5.71480 |
| Index of Refraction | 1.675 |
| InChIKey | BEBYJIKXWFFKER-UHFFFAOYSA-N |
| SMILES | Cc1c2oc3c(C)ccc(C(=O)NCc4ccccc4)c3nc-2c(C(=O)NCc2ccccc2)c(N)c1=O |
|
~%
2-amino-N,N-dib... CAS#:63879-48-1 |
| Literature: Jain,P.C. et al. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1977 , vol. 15, p. 163 - 164 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |