N,N'-Bis(3-carboxypropyl)ethanebisthioamide structure
|
Common Name | N,N'-Bis(3-carboxypropyl)ethanebisthioamide | ||
|---|---|---|---|---|
| CAS Number | 63904-88-1 | Molecular Weight | 292.37500 | |
| Density | 1.389g/cm3 | Boiling Point | 530.2ºC at 760mmHg | |
| Molecular Formula | C10H16N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.5ºC | |
| Name | 4-[[2-(3-carboxypropylamino)-2-sulfanylideneethanethioyl]amino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.389g/cm3 |
|---|---|
| Boiling Point | 530.2ºC at 760mmHg |
| Molecular Formula | C10H16N2O4S2 |
| Molecular Weight | 292.37500 |
| Flash Point | 274.5ºC |
| Exact Mass | 292.05500 |
| PSA | 162.84000 |
| LogP | 1.33180 |
| Index of Refraction | 1.613 |
| InChIKey | CCQRMRYGYNHBCP-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCNC(=S)C(=S)NCCCC(=O)O |
| HS Code | 2930909090 |
|---|
|
~%
N,N'-Bis(3-carb... CAS#:63904-88-1 |
| Literature: Hurd,R.N. et al. Journal of Organic Chemistry, 1961 , vol. 26, p. 3980 - 3987 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| usaf mk-32 |