2-(2,2-dinaphthalen-2-ylacetyl)oxyethyl-diethylazanium,chloride structure
|
Common Name | 2-(2,2-dinaphthalen-2-ylacetyl)oxyethyl-diethylazanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 63905-79-3 | Molecular Weight | 447.99600 | |
| Density | N/A | Boiling Point | 574.4ºC at 760mmHg | |
| Molecular Formula | C28H30ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170ºC | |
| Name | 2-(2,2-dinaphthalen-2-ylacetyl)oxyethyl-diethylazanium,chloride |
|---|
| Boiling Point | 574.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C28H30ClNO2 |
| Molecular Weight | 447.99600 |
| Flash Point | 170ºC |
| Exact Mass | 447.19700 |
| PSA | 29.54000 |
| LogP | 6.81190 |
| InChIKey | CNCOQPXJERKGEX-UHFFFAOYSA-N |
| SMILES | CC[NH+](CC)CCOC(=O)C(c1ccc2ccccc2c1)c1ccc2ccccc2c1.[Cl-] |
|
~%
2-(2,2-dinaphth... CAS#:63905-79-3 |
| Literature: Burtner; Cusic Journal of the American Chemical Society, 1943 , vol. 65, p. 262,263 |