2-fluoroacetate: magnesium(+2) cation structure
|
Common Name | 2-fluoroacetate: magnesium(+2) cation | ||
|---|---|---|---|---|
| CAS Number | 63905-88-4 | Molecular Weight | 178.37400 | |
| Density | N/A | Boiling Point | 167.9ºC at 760mmHg | |
| Molecular Formula | C4H4F2MgO4 | Melting Point | 35.2ºC | |
| MSDS | N/A | Flash Point | 55.3ºC | |
| Name | magnesium,2-fluoroacetate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 167.9ºC at 760mmHg |
|---|---|
| Melting Point | 35.2ºC |
| Molecular Formula | C4H4F2MgO4 |
| Molecular Weight | 178.37400 |
| Flash Point | 55.3ºC |
| Exact Mass | 177.99300 |
| PSA | 80.26000 |
| InChIKey | LFDKGAGSXQRVIR-UHFFFAOYSA-L |
| SMILES | O=C([O-])CF.O=C([O-])CF.[Mg+2] |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| magnesium 2-fluoroacetate |
| Magnesium fluoroacetate |