3,4-Dihydro-1-(2-mercaptophenyl)-4,4,6-trimethyl-2(1H)-pyrimidinethione structure
|
Common Name | 3,4-Dihydro-1-(2-mercaptophenyl)-4,4,6-trimethyl-2(1H)-pyrimidinethione | ||
|---|---|---|---|---|
| CAS Number | 63917-27-1 | Molecular Weight | 264.41000 | |
| Density | 1.24g/cm3 | Boiling Point | 359.1ºC at 760mmHg | |
| Molecular Formula | C13H16N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171ºC | |
| Name | 4,6,6-trimethyl-3-(2-sulfanylphenyl)-1H-pyrimidine-2-thione |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 359.1ºC at 760mmHg |
| Molecular Formula | C13H16N2S2 |
| Molecular Weight | 264.41000 |
| Flash Point | 171ºC |
| Exact Mass | 264.07500 |
| PSA | 93.20000 |
| LogP | 3.26410 |
| Index of Refraction | 1.666 |
| InChIKey | HYMDTYGHYSUVHW-UHFFFAOYSA-N |
| SMILES | CC1=CC(C)(C)NC(=S)N1c1ccccc1S |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |