p-Aminothiobenzoic acid S-[3-(dibutylamino)propyl] ester
Modify Date: 2025-09-24 18:53:56
![p-Aminothiobenzoic acid S-[3-(dibutylamino)propyl] ester Structure](https://image.chemsrc.com/caspic/244/63917-80-6.png)
p-Aminothiobenzoic acid S-[3-(dibutylamino)propyl] ester structure
|
Common Name | p-Aminothiobenzoic acid S-[3-(dibutylamino)propyl] ester | ||
|---|---|---|---|---|
| CAS Number | 63917-80-6 | Molecular Weight | 322.50900 | |
| Density | 1.041g/cm3 | Boiling Point | 441.2ºC at 760mmHg | |
| Molecular Formula | C18H30N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.6ºC | |
| Name | O-[3-(dibutylamino)propyl] 4-aminobenzenecarbothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.041g/cm3 |
|---|---|
| Boiling Point | 441.2ºC at 760mmHg |
| Molecular Formula | C18H30N2OS |
| Molecular Weight | 322.50900 |
| Flash Point | 220.6ºC |
| Exact Mass | 322.20800 |
| PSA | 70.58000 |
| LogP | 4.83440 |
| Index of Refraction | 1.555 |
| InChIKey | USDBVRPFFFHQMD-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)CCCOC(=S)c1ccc(N)cc1 |
| HS Code | 2930909090 |
|---|
|
~%
p-Aminothiobenz... CAS#:63917-80-6 |
| Literature: Lischer; Jordan Journal of the American Chemical Society, 1937 , vol. 59, p. 1623 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Di-n-butylaminopropyl-p-aminothiobenzoate |
| USAF A-9869 |