7-(2-chloroethyl)-N,N-dimethyl-7H-phenothiazin-1-amine structure
|
Common Name | 7-(2-chloroethyl)-N,N-dimethyl-7H-phenothiazin-1-amine | ||
|---|---|---|---|---|
| CAS Number | 63918-80-9 | Molecular Weight | 304.83800 | |
| Density | 1.25g/cm3 | Boiling Point | 475.8ºC at 760mmHg | |
| Molecular Formula | C16H17ClN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.6ºC | |
| Name | 7-(2-chloroethyl)-N,N-dimethyl-7H-phenothiazin-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 475.8ºC at 760mmHg |
| Molecular Formula | C16H17ClN2S |
| Molecular Weight | 304.83800 |
| Flash Point | 241.6ºC |
| Exact Mass | 304.08000 |
| PSA | 40.90000 |
| LogP | 4.06520 |
| Index of Refraction | 1.643 |
| InChIKey | AEXSKGDWVVLMEM-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc2c1N=C1C=CC(CCCl)C=C1S2 |
| USAF ND-66 |
| 3-Ethochloride of 9-dimethylamine 3-isophenothiazine |