8-Methyl-10H-pyrido[3,2-b]pyrimido[4,5-e][1,4]thiazine-2,4-diamine structure
|
Common Name | 8-Methyl-10H-pyrido[3,2-b]pyrimido[4,5-e][1,4]thiazine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 63931-09-9 | Molecular Weight | 246.29200 | |
| Density | 1.519g/cm3 | Boiling Point | 592.7ºC at 760mmHg | |
| Molecular Formula | C10H10N6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.3ºC | |
| Name | brn 0544876 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.519g/cm3 |
|---|---|
| Boiling Point | 592.7ºC at 760mmHg |
| Molecular Formula | C10H10N6S |
| Molecular Weight | 246.29200 |
| Flash Point | 312.3ºC |
| Exact Mass | 246.06900 |
| PSA | 135.47000 |
| LogP | 2.11390 |
| Index of Refraction | 1.784 |
| InChIKey | RGBIYOVCIRBCTL-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(n1)Nc1nc(N)nc(N)c1S2 |
| HS Code | 2934999090 |
|---|
|
~%
8-Methyl-10H-py... CAS#:63931-09-9 |
| Literature: Okafor,C.O. et al. European Journal of Medicinal Chemistry, 1977 , vol. 12, p. 249 - 256 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-Diamino-8-methyl-1,3,9-triazaphenothiazine |