10H-Pyrido[2,3-b]pyrimido[4,5-e][1,4]thiazin-2-amine,4-chloro-7-methoxy- structure
|
Common Name | 10H-Pyrido[2,3-b]pyrimido[4,5-e][1,4]thiazin-2-amine,4-chloro-7-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 63931-20-4 | Molecular Weight | 281.72100 | |
| Density | 1.569g/cm3 | Boiling Point | 568.3ºC at 760 mmHg | |
| Molecular Formula | C10H8ClN5OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.5ºC | |
| Name | nsc194990 |
|---|
| Density | 1.569g/cm3 |
|---|---|
| Boiling Point | 568.3ºC at 760 mmHg |
| Molecular Formula | C10H8ClN5OS |
| Molecular Weight | 281.72100 |
| Flash Point | 297.5ºC |
| Exact Mass | 281.01400 |
| PSA | 114.48000 |
| LogP | 1.76270 |
| Index of Refraction | 1.718 |
| InChIKey | SYPWETXIZLBSCE-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(n1)Sc1c(Cl)nc(N)nc1N2 |
|
~%
10H-Pyrido[2,3-... CAS#:63931-20-4 |
| Literature: Okafor,C.O. et al. European Journal of Medicinal Chemistry, 1977 , vol. 12, p. 249 - 256 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |