2-Methyl-1-(2-nitrophenethyl)-1,2,3,4,5,6,7,8-octahydroisoquinoline structure
|
Common Name | 2-Methyl-1-(2-nitrophenethyl)-1,2,3,4,5,6,7,8-octahydroisoquinoline | ||
|---|---|---|---|---|
| CAS Number | 63938-00-1 | Molecular Weight | 300.39500 | |
| Density | 1.15g/cm3 | Boiling Point | 433.5ºC at 760 mmHg | |
| Molecular Formula | C18H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216ºC | |
| Name | 2-methyl-1-[2-(2-nitrophenyl)ethyl]-3,4,5,6,7,8-hexahydro-1H-isoquinoline |
|---|
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 433.5ºC at 760 mmHg |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.39500 |
| Flash Point | 216ºC |
| Exact Mass | 300.18400 |
| PSA | 49.06000 |
| LogP | 4.56320 |
| Index of Refraction | 1.586 |
| InChIKey | MFBGBDQKGVVUET-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(CCCC2)C1CCc1ccccc1[N+](=O)[O-] |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |