3-[1-(4-Aminophenethyl)-3-propyl-3-pyrrolidinyl]phenol structure
|
Common Name | 3-[1-(4-Aminophenethyl)-3-propyl-3-pyrrolidinyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 63951-04-2 | Molecular Weight | 324.46000 | |
| Density | 1.098g/cm3 | Boiling Point | 500.8ºC at 760mmHg | |
| Molecular Formula | C21H28N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.7ºC | |
| Name | 3-[1-[2-(4-aminophenyl)ethyl]-3-propylpyrrolidin-3-yl]phenol |
|---|
| Density | 1.098g/cm3 |
|---|---|
| Boiling Point | 500.8ºC at 760mmHg |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.46000 |
| Flash Point | 256.7ºC |
| Exact Mass | 324.22000 |
| PSA | 49.49000 |
| LogP | 4.47980 |
| Index of Refraction | 1.593 |
| InChIKey | HPOUDGQCZNPFSH-UHFFFAOYSA-N |
| SMILES | CCCC1(c2cccc(O)c2)CCN(CCc2ccc(N)cc2)C1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |