[5-chloro-2-(2-phenylethynyl)phenyl]-ethoxyphosphinate structure
|
Common Name | [5-chloro-2-(2-phenylethynyl)phenyl]-ethoxyphosphinate | ||
|---|---|---|---|---|
| CAS Number | 639517-07-0 | Molecular Weight | 319.69900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13ClO3P- | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [5-chloro-2-(2-phenylethynyl)phenyl]-ethoxyphosphinate |
|---|
| Molecular Formula | C16H13ClO3P- |
|---|---|
| Molecular Weight | 319.69900 |
| Exact Mass | 319.02900 |
| PSA | 59.17000 |
| LogP | 4.02520 |
| InChIKey | ROJZASIEKFJLIV-UHFFFAOYSA-M |
| SMILES | CCOP(=O)([O-])c1cc(Cl)ccc1C#Cc1ccccc1 |
|
~93%
[5-chloro-2-(2-... CAS#:639517-07-0 |
| Literature: Peng, Ai-Yun; Ding, Yi-Xiang Journal of the American Chemical Society, 2003 , vol. 125, # 49 p. 15006 - 15007 |