4,5-dihydroxyphthalic acid structure
|
Common Name | 4,5-dihydroxyphthalic acid | ||
|---|---|---|---|---|
| CAS Number | 63958-66-7 | Molecular Weight | 198.13000 | |
| Density | 1.779g/cm3 | Boiling Point | 535.8ºC at 760mmHg | |
| Molecular Formula | C8H6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.9ºC | |
| Name | 4,5-dihydroxyphthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.779g/cm3 |
|---|---|
| Boiling Point | 535.8ºC at 760mmHg |
| Molecular Formula | C8H6O6 |
| Molecular Weight | 198.13000 |
| Flash Point | 291.9ºC |
| Exact Mass | 198.01600 |
| PSA | 115.06000 |
| LogP | 0.49420 |
| Index of Refraction | 1.717 |
| InChIKey | YZBCICVNBHNLTK-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(O)c(O)cc1C(=O)O |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 1,2-Benzenedicarboxylic acid,4,5-dihydroxy |
| 4,5-Dhpa |