4-(4-Chlorophenyl)-4-hydroxy-a,a-diphenyl-1-piperidinebutanenitrile structure
|
Common Name | 4-(4-Chlorophenyl)-4-hydroxy-a,a-diphenyl-1-piperidinebutanenitrile | ||
|---|---|---|---|---|
| CAS Number | 63959-33-1 | Molecular Weight | 430.96900 | |
| Density | 1.205g/cm3 | Boiling Point | 626.907ºC at 760 mmHg | |
| Molecular Formula | C27H27ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 332.942ºC | |
| Name | 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylbutanenitrile |
|---|
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 626.907ºC at 760 mmHg |
| Molecular Formula | C27H27ClN2O |
| Molecular Weight | 430.96900 |
| Flash Point | 332.942ºC |
| Exact Mass | 430.18100 |
| PSA | 47.26000 |
| LogP | 5.46128 |
| Index of Refraction | 1.613 |
| InChIKey | WQHHIUPVMNFPJC-UHFFFAOYSA-N |
| SMILES | N#CC(CCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccccc1)c1ccccc1 |
|
~72%
4-(4-Chlorophen... CAS#:63959-33-1 |
| Literature: Wang, Min; Gao, Mingzhang; Zheng, Qi-Huang Bioorganic and Medicinal Chemistry Letters, 2013 , vol. 23, # 19 p. 5259 - 5263 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |