N-(1,3-benzothiazol-2-ylcarbamothioyl)-3,4,5-trimethoxybenzamide structure
|
Common Name | N-(1,3-benzothiazol-2-ylcarbamothioyl)-3,4,5-trimethoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 6396-53-8 | Molecular Weight | 403.47500 | |
| Density | 1.403g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H17N3O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(1,3-benzothiazol-2-ylcarbamothioyl)-3,4,5-trimethoxybenzamide |
|---|
| Density | 1.403g/cm3 |
|---|---|
| Molecular Formula | C18H17N3O4S2 |
| Molecular Weight | 403.47500 |
| Exact Mass | 403.06600 |
| PSA | 152.57000 |
| LogP | 4.24420 |
| Index of Refraction | 1.696 |
| InChIKey | FLLWEDAVHWGLNG-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)NC(=S)Nc2nc3ccccc3s2)cc(OC)c1OC |
|
~%
N-(1,3-benzothi... CAS#:6396-53-8 |
| Literature: Kousaka, Takeshi; Mori, Kenji Bioscience, Biotechnology and Biochemistry, 2002 , vol. 66, # 3 p. 697 - 701 |
|
~%
N-(1,3-benzothi... CAS#:6396-53-8 |
| Literature: Kousaka, Takeshi; Mori, Kenji Bioscience, Biotechnology and Biochemistry, 2002 , vol. 66, # 3 p. 697 - 701 |