N-(3-benzamidophenyl)-4-[(4-chlorophenyl)methoxy]-3-methoxybenzamide structure
|
Common Name | N-(3-benzamidophenyl)-4-[(4-chlorophenyl)methoxy]-3-methoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 6397-27-9 | Molecular Weight | 486.94600 | |
| Density | 1.323g/cm3 | Boiling Point | 547.2ºC at 760mmHg | |
| Molecular Formula | C28H23ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.7ºC | |
| Name | N-(3-benzamidophenyl)-4-[(4-chlorophenyl)methoxy]-3-methoxybenzamide |
|---|
| Density | 1.323g/cm3 |
|---|---|
| Boiling Point | 547.2ºC at 760mmHg |
| Molecular Formula | C28H23ClN2O4 |
| Molecular Weight | 486.94600 |
| Flash Point | 284.7ºC |
| Exact Mass | 486.13500 |
| PSA | 83.64000 |
| LogP | 7.20020 |
| Index of Refraction | 1.674 |
| InChIKey | XZQFQCRSBJSYTR-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)Nc2cccc(NC(=O)c3ccccc3)c2)ccc1OCc1ccc(Cl)cc1 |
|
~%
N-(3-benzamidop... CAS#:6397-27-9 |
| Literature: Prasad,R.N.; Tietje,K. Canadian Journal of Chemistry, 1966 , vol. 44, p. 1247 - 1258 |