3-hydroxy-1,3-diphenylbutan-1-one
Modify Date: 2026-06-30 12:20:40
3-hydroxy-1,3-diphenylbutan-1-one structure
|
Common Name | 3-hydroxy-1,3-diphenylbutan-1-one | ||
|---|---|---|---|---|
| CAS Number | 6397-70-2 | Molecular Weight | 240.29700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-hydroxy-1,3-diphenylbutan-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H16O2 |
|---|---|
| Molecular Weight | 240.29700 |
| Exact Mass | 240.11500 |
| PSA | 37.30000 |
| LogP | 3.16710 |
| InChIKey | UYNBPSVTHPEZPX-UHFFFAOYSA-N |
| SMILES | CC(O)(CC(=O)c1ccccc1)c1ccccc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Butanone,3-hydroxy-1,3-diphenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 3-hydroxy-1,3-diphenylbutan-1-one? |
| A: Polar surface area (PSA) of 3-hydroxy-1,3-diphenylbutan-1-one is 37.30000. |
| Q: What is the SMILES notation of 3-hydroxy-1,3-diphenylbutan-1-one? |
| A: SMILES notation of 3-hydroxy-1,3-diphenylbutan-1-one is CC(O)(CC(=O)c1ccccc1)c1ccccc1. |
| Q: What is the LogP of 3-hydroxy-1,3-diphenylbutan-1-one? |
| A: LogP of 3-hydroxy-1,3-diphenylbutan-1-one is 3.16710. |
| Q: What is the molecular formula of 3-hydroxy-1,3-diphenylbutan-1-one? |
| A: Molecular formula of 3-hydroxy-1,3-diphenylbutan-1-one is C16H16O2. |
| Q: What is the English name of 3-hydroxy-1,3-diphenylbutan-1-one? |
| A: The English name of 3-hydroxy-1,3-diphenylbutan-1-one is 3-hydroxy-1,3-diphenylbutan-1-one. |
| Q: What is the CAS number of 3-hydroxy-1,3-diphenylbutan-1-one? |
| A: CAS number of 3-hydroxy-1,3-diphenylbutan-1-one is 6397-70-2. |
| Q: What is the InChIKey of 3-hydroxy-1,3-diphenylbutan-1-one? |
| A: InChIKey of 3-hydroxy-1,3-diphenylbutan-1-one is UYNBPSVTHPEZPX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 6397-70-2? |
| A: Chinese name of 6397-70-2 is 6397-70-2. |
| Q: What is the molecular weight of 3-hydroxy-1,3-diphenylbutan-1-one? |
| A: Molecular weight of 3-hydroxy-1,3-diphenylbutan-1-one is 240.29700. |
| Q: What English synonyms does 3-hydroxy-1,3-diphenylbutan-1-one have? |
| A: English synonyms of 3-hydroxy-1,3-diphenylbutan-1-one: 1-Butanone,3-hydroxy-1,3-diphenyl. |