3-Benzyl-8-propionyl-3,8-diazabicyclo[3.2.1]octane structure
|
Common Name | 3-Benzyl-8-propionyl-3,8-diazabicyclo[3.2.1]octane | ||
|---|---|---|---|---|
| CAS Number | 63978-12-1 | Molecular Weight | 258.35900 | |
| Density | 1.117g/cm3 | Boiling Point | 400.7ºC at 760 mmHg | |
| Molecular Formula | C16H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.5ºC | |
| Name | 1-(3-benzyl-3,8-diazabicyclo[3.2.1]octan-8-yl)propan-1-one |
|---|
| Density | 1.117g/cm3 |
|---|---|
| Boiling Point | 400.7ºC at 760 mmHg |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.35900 |
| Flash Point | 170.5ºC |
| Exact Mass | 258.17300 |
| PSA | 23.55000 |
| LogP | 2.14760 |
| Index of Refraction | 1.57 |
| InChIKey | MAQBLRFYCNOQJD-UHFFFAOYSA-N |
| SMILES | CCC(=O)N1C2CCC1CN(Cc1ccccc1)C2 |
| HS Code | 2933990090 |
|---|
|
~%
3-Benzyl-8-prop... CAS#:63978-12-1 |
| Literature: Barlocco; Cignarella; Vianello; Villa; Pinna; Fadda; Fratta Farmaco, 1998 , vol. 53, # 8-9 p. 557 - 562 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |