1-(2,5-Dimethoxybenzyl)-4-phenylpiperazine structure
|
Common Name | 1-(2,5-Dimethoxybenzyl)-4-phenylpiperazine | ||
|---|---|---|---|---|
| CAS Number | 63978-38-1 | Molecular Weight | 460.82500 | |
| Density | 1.119g/cm3 | Boiling Point | 443.1ºC at 760mmHg | |
| Molecular Formula | C21H28Cl3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.9ºC | |
| Name | 2-[3-[(6-chloro-2-methoxyacridin-9-yl)amino]propyl-ethylamino]ethanol,dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.119g/cm3 |
|---|---|
| Boiling Point | 443.1ºC at 760mmHg |
| Molecular Formula | C21H28Cl3N3O2 |
| Molecular Weight | 460.82500 |
| Flash Point | 127.9ºC |
| Exact Mass | 459.12500 |
| PSA | 60.85000 |
| LogP | 5.19210 |
| Index of Refraction | 1.577 |
| InChIKey | PFYFLYATHIETIY-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(CN2CCN(c3ccccc3)CC2)c1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Icr 170-OH |