diethyl-[2-(naphthalene-1-carbonyloxy)ethyl]azanium,chloride structure
|
Common Name | diethyl-[2-(naphthalene-1-carbonyloxy)ethyl]azanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 63979-15-7 | Molecular Weight | 307.81500 | |
| Density | N/A | Boiling Point | 397.3ºC at 760mmHg | |
| Molecular Formula | C17H22ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.7ºC | |
| Name | diethyl-[2-(naphthalene-1-carbonyloxy)ethyl]azanium,chloride |
|---|
| Boiling Point | 397.3ºC at 760mmHg |
|---|---|
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.81500 |
| Flash Point | 137.7ºC |
| Exact Mass | 307.13400 |
| PSA | 29.54000 |
| LogP | 4.14040 |
| InChIKey | UXQSJMBMFDCPMM-UHFFFAOYSA-N |
| SMILES | CC[NH+](CC)CCOC(=O)c1cccc2ccccc12.[Cl-] |
|
~%
diethyl-[2-(nap... CAS#:63979-15-7 |
| Literature: Burtner; Cusic Journal of the American Chemical Society, 1943 , vol. 65, p. 1582 |
|
~%
diethyl-[2-(nap... CAS#:63979-15-7 |
| Literature: Bjerregard; Houston Pr. Oklahoma Acad., 1934 , vol. 14, p. 77 |