Trichloroacryloylurea structure
|
Common Name | Trichloroacryloylurea | ||
|---|---|---|---|---|
| CAS Number | 63979-42-0 | Molecular Weight | 217.43800 | |
| Density | 1.689g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C4H3Cl3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-carbamoyl-2,3,3-trichloroprop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.689g/cm3 |
|---|---|
| Molecular Formula | C4H3Cl3N2O2 |
| Molecular Weight | 217.43800 |
| Exact Mass | 215.92600 |
| PSA | 76.67000 |
| LogP | 2.42090 |
| Index of Refraction | 1.567 |
| InChIKey | XDRPZJKGCIPXFO-UHFFFAOYSA-N |
| SMILES | NC(=O)NC(=O)C(Cl)=C(Cl)Cl |
| HS Code | 2924210090 |
|---|
|
~%
Trichloroacrylo... CAS#:63979-42-0 |
| Literature: Fritsch Justus Liebigs Annalen der Chemie, 1897 , vol. 297, p. 314 |
| HS Code | 2924210090 |
|---|---|
| Summary | 2924210090 other ureines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Trichloracrylsaeure-ureid |
| trichloroacryloyl-urea |
| Urea,trichloroacroyl |
| Trichloroacroylurea |
| Trichloracryloyl-harnstoff |