[(3,4-Dichlorophenyl)methyl]phosphonic acid diethyl ester structure
|
Common Name | [(3,4-Dichlorophenyl)methyl]phosphonic acid diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 63980-05-2 | Molecular Weight | 297.11500 | |
| Density | 1.277g/cm3 | Boiling Point | 380.7ºC at 760mmHg | |
| Molecular Formula | C11H15Cl2O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.4ºC | |
| Name | Diethyl (3,4-dichlorobenzyl)phosphonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 380.7ºC at 760mmHg |
| Molecular Formula | C11H15Cl2O3P |
| Molecular Weight | 297.11500 |
| Flash Point | 278.4ºC |
| Exact Mass | 296.01400 |
| PSA | 45.34000 |
| LogP | 4.75950 |
| Index of Refraction | 1.512 |
| InChIKey | YLRGYDLFTIIAOG-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(Cc1ccc(Cl)c(Cl)c1)OCC |
|
~%
[(3,4-Dichlorop... CAS#:63980-05-2 |
| Literature: Gong, Leyi Patent: US2004/176416 A1, 2004 ; Location in patent: Page/Page column 10 ; US 20040176416 A1 |
|
~%
[(3,4-Dichlorop... CAS#:63980-05-2 |
| Literature: BAYLOR COLLEGE OF MEDICINE; SONG, Yongcheng Patent: WO2011/46920 A1, 2011 ; Location in patent: Page/Page column 89-90 ; |
|
~%
[(3,4-Dichlorop... CAS#:63980-05-2 |
| Literature: BAYLOR COLLEGE OF MEDICINE; SONG, Yongcheng Patent: WO2011/46920 A1, 2011 ; |
|
~%
[(3,4-Dichlorop... CAS#:63980-05-2 |
| Literature: BAYLOR COLLEGE OF MEDICINE; SONG, Yongcheng Patent: WO2011/46920 A1, 2011 ; |
| N-Carboxymethyl-dichlormaleinimid |
| N-dichlormaleolyl-L-glycin |
| 3,4-Dichlor-benzylphosphonsaeure-diaethylester |
| N-dichloromaleolyl-glycine,ethyl ester |
| N-dichlormaleolyl-L-glycinethylester |
| diethyl 3,4-dichlorobenzylphosphonate |
| N-dichloromaleolyl-glycine |
| diethyl 3,4-dichlorobenzylphosphate |
| N-Carbethoxymethyl-dichlormaleimid |