Thiophosphoric acid O,O-dimethyl O-(2-chloro-4-cyanophenyl) ester structure
|
Common Name | Thiophosphoric acid O,O-dimethyl O-(2-chloro-4-cyanophenyl) ester | ||
|---|---|---|---|---|
| CAS Number | 63981-11-3 | Molecular Weight | 277.66400 | |
| Density | 1.41g/cm3 | Boiling Point | 339.2ºC at 760mmHg | |
| Molecular Formula | C9H9ClNO3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.9ºC | |
| Name | 3-chloro-4-dimethoxyphosphinothioyloxybenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 339.2ºC at 760mmHg |
| Molecular Formula | C9H9ClNO3PS |
| Molecular Weight | 277.66400 |
| Flash Point | 158.9ºC |
| Exact Mass | 276.97300 |
| PSA | 93.38000 |
| LogP | 3.75838 |
| Index of Refraction | 1.567 |
| InChIKey | IHPVQWQTPXUIGW-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)Oc1ccc(C#N)cc1Cl |
| Phosphorothioic acid,O,O-dimethyl ester,O-ester with 3-chloro-4-hydroxybenzonitrile |