[4-(dimethylcarbamoyloxy)-2-ethylphenyl]-trimethylazanium,iodide structure
|
Common Name | [4-(dimethylcarbamoyloxy)-2-ethylphenyl]-trimethylazanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 63981-69-1 | Molecular Weight | 378.24900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H23IN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-(dimethylcarbamoyloxy)-2-ethylphenyl]-trimethylazanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H23IN2O2 |
|---|---|
| Molecular Weight | 378.24900 |
| Exact Mass | 378.08000 |
| PSA | 29.54000 |
| InChIKey | FQWMVGJQWMIQMQ-UHFFFAOYSA-M |
| SMILES | CCc1cc(OC(=O)N(C)C)ccc1[N+](C)(C)C.[I-] |
|
~%
[4-(dimethylcar... CAS#:63981-69-1 |
| Literature: Stevens; Beutel Journal of the American Chemical Society, 1941 , vol. 63, p. 308,309 |
| 2-Aethyl-4-dimethylamino-2-phenyl-butyronitril |
| 2-ethyl-4-dimethylcarbamoyloxy-tri-N-methyl-anilinium,iodide |
| 2-Aethyl-4-dimethylcarbamoyloxy-tri-N-methyl-anilinium,Jodid |
| 2-ethyl-4-dimethylamino-2-phenyl-butyronitrile |