dimethyl-[3-(methylcarbamoyloxy)phenyl]azanium,chloride structure
|
Common Name | dimethyl-[3-(methylcarbamoyloxy)phenyl]azanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 63982-40-1 | Molecular Weight | 230.69100 | |
| Density | N/A | Boiling Point | 298ºC at 760mmHg | |
| Molecular Formula | C10H15ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134ºC | |
| Name | dimethyl-[3-(methylcarbamoyloxy)phenyl]azanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 298ºC at 760mmHg |
|---|---|
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.69100 |
| Flash Point | 134ºC |
| Exact Mass | 230.08200 |
| PSA | 45.06000 |
| LogP | 2.47720 |
| InChIKey | MAGSEXCSJCBCOB-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1cccc([NH+](C)C)c1.[Cl-] |
| Methylcarbamic ester of 3-oxyphenyldimethylamine hydrochloride |
| N-Methylurethane of hydrochloride of 3-dimethylaminophenol |