dimethyl-[2-methyl-5-(methylcarbamoyloxy)phenyl]azanium,chloride structure
|
Common Name | dimethyl-[2-methyl-5-(methylcarbamoyloxy)phenyl]azanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 63982-47-8 | Molecular Weight | 244.71800 | |
| Density | N/A | Boiling Point | 307.6ºC at 760mmHg | |
| Molecular Formula | C11H17ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.8ºC | |
| Name | dimethyl-[2-methyl-5-(methylcarbamoyloxy)phenyl]azanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 307.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C11H17ClN2O2 |
| Molecular Weight | 244.71800 |
| Flash Point | 139.8ºC |
| Exact Mass | 244.09800 |
| PSA | 45.06000 |
| LogP | 2.78560 |
| InChIKey | KWENXLVKXBGHNK-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1ccc(C)c([NH+](C)C)c1.[Cl-] |
| Carbamic acid,N-methyl-,3-dimethylamino-4-methylphenyl ester,hydrochloride |
| N-Methylurethane of hydrochloride of 2-dimethylamino-p-cresol |
| T-1768 |