4-Piperidinone,2,2,6,6-tetramethyl-1-nitroso- structure
|
Common Name | 4-Piperidinone,2,2,6,6-tetramethyl-1-nitroso- | ||
|---|---|---|---|---|
| CAS Number | 640-01-7 | Molecular Weight | 184.23600 | |
| Density | 1.1g/cm3 | Boiling Point | 296.7ºC at 760 mmHg | |
| Molecular Formula | C9H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.3ºC | |
| Name | 2,2,6,6-tetramethyl-1-nitrosopiperidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 296.7ºC at 760 mmHg |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.23600 |
| Flash Point | 133.3ºC |
| Exact Mass | 184.12100 |
| PSA | 49.74000 |
| LogP | 1.82780 |
| Index of Refraction | 1.519 |
| InChIKey | PBOJDTWOZVDRPH-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)CC(C)(C)N1N=O |
| HS Code | 2933399090 |
|---|
|
~57%
4-Piperidinone,... CAS#:640-01-7 |
| Literature: Shustov, G. V.; Tavakalyan, N. B.; Shustova, L. L.; Chervin, I. I.; Kostyanovskii, R. G. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1980 , vol. 29, # 5 p. 765 - 770 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1980 , # 5 p. 1058 - 1063 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-nitroso-2,2,6,6-tetramethyl-4-piperidone |
| 2,2,6,6-Tetramethyl-1-nitroso-4-piperidone |
| 1-Nitroso-2,2,6,6-tetramethyl-piperidin-4-on |
| 2,2,6,6-Tetramethyl-1-nitroso-4-piperidon |
| N-Nitroso-Triacetonamin |
| 1-nitroso-2,2,6,6-tetramethyl-4-piperidone |
| 2,2,6,6-Tetramethyl-1-nitroso-4-piperidinone |
| 2,2,6,6-Tetramethyl-1-nitroso-piperidin-4-on |
| 2,2,6,6-tetramethyl-1-nitroso-piperidin-4-one |