acetic acid,(4-fluorophenyl)methanediol structure
|
Common Name | acetic acid,(4-fluorophenyl)methanediol | ||
|---|---|---|---|---|
| CAS Number | 64002-52-4 | Molecular Weight | 262.23200 | |
| Density | 1.231g/cm3 | Boiling Point | 290.8ºC at 760 mmHg | |
| Molecular Formula | C11H15FO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.6ºC | |
| Name | acetic acid,(4-fluorophenyl)methanediol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 290.8ºC at 760 mmHg |
| Molecular Formula | C11H15FO6 |
| Molecular Weight | 262.23200 |
| Flash Point | 125.6ºC |
| Exact Mass | 262.08500 |
| PSA | 115.06000 |
| LogP | 0.99070 |
| Index of Refraction | 1.491 |
| InChIKey | KYTOFNIAVJDMJX-UHFFFAOYSA-N |
| SMILES | CC(=O)O.CC(=O)O.OC(O)c1ccc(F)cc1 |
|
~98%
acetic acid,(4-... CAS#:64002-52-4 |
| Literature: Jung, Misuk; Yoon, Jieun; Kim, Hak Sung; Ryu, Jae-Sang Synthesis, 2010 , # 16 art. no. F04310SS, p. 2713 - 2720 |
|
~84%
acetic acid,(4-... CAS#:64002-52-4 |
| Literature: Pourmousavi, Seied Ali; Hadavankhani, Majid; Zinati, Zahra E-Journal of Chemistry, 2011 , vol. 8, # SUPPL. 1 p. S495-S501 |
| 4-fluorobenzaldehyde-1,1-diacetate |
| 4-fluorobenzylidene diacetate |