3-ethyl 4,5-dihydro-5-oxo-1-(4-sulphophenyl)-1H-pyrazole-3-carboxylate
Modify Date: 2025-09-13 12:18:39
3-ethyl 4,5-dihydro-5-oxo-1-(4-sulphophenyl)-1H-pyrazole-3-carboxylate structure
|
Common Name | 3-ethyl 4,5-dihydro-5-oxo-1-(4-sulphophenyl)-1H-pyrazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 6402-06-8 | Molecular Weight | 312.29800 | |
| Density | 1.54g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3-ethoxycarbonyl-5-oxo-4H-pyrazol-1-yl)benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Molecular Formula | C12H12N2O6S |
| Molecular Weight | 312.29800 |
| Exact Mass | 312.04200 |
| PSA | 121.72000 |
| LogP | 1.17050 |
| Index of Refraction | 1.645 |
| InChIKey | ODFCMJFINVPRFA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(c2ccc(S(=O)(=O)O)cc2)C(=O)C1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 229-016-8 |