2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide
2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide structure
|
Common Name | 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 6402-60-4 | Molecular Weight | 309.78600 | |
| Density | 1.32g/cm3 | Boiling Point | 472.5ºC at 760 mmHg | |
| Molecular Formula | C15H13ClFNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 472.5ºC at 760 mmHg |
| Molecular Formula | C15H13ClFNOS |
| Molecular Weight | 309.78600 |
| Flash Point | 239.5ºC |
| Exact Mass | 309.03900 |
| PSA | 54.40000 |
| LogP | 4.67140 |
| Index of Refraction | 1.616 |
| InChIKey | YNDYARGPZGMYQO-UHFFFAOYSA-N |
| SMILES | CC(Sc1ccc(Cl)cc1)C(=O)Nc1ccc(F)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-(4-chlorophen... CAS#:6402-60-4 |
| Literature: Emeleus, H. J.; Miller, N. Journal of the Chemical Society, 1939 , p. 819 - 823 Full Text View citing articles Show Details Emeleus, H. J.; Miller, N. Nature (London, United Kingdom), 1938 , vol. 142, p. 996 - 997 |
|
~%
2-(4-chlorophen... CAS#:6402-60-4 |
| Literature: Emeleus; Miller Journal of the Chemical Society, 1939 , p. 819 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Aethyl-disilazan |
| 2-ethyl-disilazane |
| Disilyl-aethyl-amin |
| ethyldisilylamine |
| N,N-Disilylethylamin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide? |
| A: CAS number of 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide is 6402-60-4. |
| Q: What is the InChIKey of 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide? |
| A: InChIKey of 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide is YNDYARGPZGMYQO-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide? |
| A: Molecular formula of 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide is C15H13ClFNOS. |
| Q: What is the Chinese name of 6402-60-4? |
| A: Chinese name of 6402-60-4 is 6402-60-4. |
| Q: What is the polar surface area (PSA) of 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide? |
| A: Polar surface area (PSA) of 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide is 54.40000. |
| Q: What English synonyms does 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide have? |
| A: English synonyms of 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide: 2-Aethyl-disilazan, 2-ethyl-disilazane, Disilyl-aethyl-amin, ethyldisilylamine, N,N-Disilylethylamin. |
| Q: What is the English name of 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide? |
| A: The English name of 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide is 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide. |
| Q: What is the molecular weight of 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide? |
| A: Molecular weight of 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide is 309.78600. |
| Q: What is the boiling point of 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide? |
| A: Boiling point of 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide is 472.5ºC at 760 mmHg. |
| Q: What is the LogP of 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide? |
| A: LogP of 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)propanamide is 4.67140. |