(αS)-α-Amino-1-benzyl-5-methoxy-1H-indole-3-propionic acid structure
|
Common Name | (αS)-α-Amino-1-benzyl-5-methoxy-1H-indole-3-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 64024-04-0 | Molecular Weight | 324.37400 | |
| Density | 1.24g/cm3 | Boiling Point | 560.8ºC at 760 mmHg | |
| Molecular Formula | C19H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.9ºC | |
| Name | 2-amino-3-(1-benzyl-5-methoxyindol-3-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 560.8ºC at 760 mmHg |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.37400 |
| Flash Point | 292.9ºC |
| Exact Mass | 324.14700 |
| PSA | 77.48000 |
| LogP | 3.35290 |
| Index of Refraction | 1.617 |
| InChIKey | UXMTUUFYPGQFAE-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)c(CC(N)C(=O)O)cn2Cc1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| DL-1-Benzyl-5-methoxy-tryptophan |
| Tryptophan,1-benzyl-5-methoxy |
| 1-Benzyl-5-methoxytryptophan |