trimethyl-[3-methyl-5-(methylcarbamoyloxy)phenyl]azanium,iodide structure
|
Common Name | trimethyl-[3-methyl-5-(methylcarbamoyloxy)phenyl]azanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 64050-11-9 | Molecular Weight | 350.19600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19IN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[3-methyl-5-(methylcarbamoyloxy)phenyl]azanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H19IN2O2 |
|---|---|
| Molecular Weight | 350.19600 |
| Exact Mass | 350.04900 |
| PSA | 44.65000 |
| LogP | 2.98500 |
| InChIKey | XXNORFZHPIWSBW-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1cc(C)cc([N+](C)(C)C)c1.[I-] |
| HS Code | 2924299090 |
|---|
|
~%
trimethyl-[3-me... CAS#:64050-11-9 |
| Literature: Haworth; Lamberton; Woodcock Journal of the Chemical Society, 1947 , p. 179 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Carbamic acid,N-methyl-,3-dimethylamino-5-methylphenyl ester,methiodide |
| 3,N,N,N-tetramethyl-5-methylcarbamoyloxy-anilinium,iodide |
| Methiodide of N-methylurethane of 4-dimethylamino-o-cresol |
| 3,N,N,N-Tetramethyl-5-methylcarbamoyloxy-anilinium,Jodid |
| Carbamic acid,methyl-,3-trimethylammonio-m-tolyl ester,iodide |
| T-1740 |